About triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane
triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane (PubChem CID 71329016) has the molecular formula C28H28O4Si
and a molecular weight of 456.61 g/mol. Its IUPAC name is triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane.
Molecular Properties
| Compound Name | triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane |
| PubChem CID | 71329016 |
| Molecular Formula | C28H28O4Si |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane |
| SMILES | COc1cc(CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H28O4Si/c1-29-26-19-22(20-27(30-2)28(26)31-3)21-32-33(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-20H,21H2,1-3H3 |
| InChIKey | PFISOXVMCIYGER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane?
The IUPAC name of triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane (CID 71329016) is triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane.
What is the SMILES notation for triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane?
The canonical SMILES for triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane is COc1cc(CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.
What is the InChIKey of triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane?
The InChIKey is PFISOXVMCIYGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28O4Si/c1-29-26-19-22(20-27(30-2)28(26)31-3)21-32-33(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-20H,21H2,1-3H3.
What are the key properties of triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane?
triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane has a molecular weight of 456.61 g/mol, XLogP of 3.90, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl-[(3,4,5-trimethoxyphenyl)methoxy]silane is sourced from PubChem (CID 71329016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).