C21H29NO4 — CID 12926477
N-methyl-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butan-2-amine (PubChem CID 12926477) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-methyl-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butan-2-amine.
| Compound Name | N-methyl-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butan-2-amine |
|---|---|
| PubChem CID | 12926477 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-methyl-2-phenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]butan-2-amine |
| SMILES | CCC(COCc1cc(OC)c(OC)c(OC)c1)(NC)c1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-6-21(22-2,17-10-8-7-9-11-17)15-26-14-16-12-18(23-3)20(25-5)19(13-16)24-4/h7-13,22H,6,14-15H2,1-5H3 |
| InChIKey | AJWXAEGSPFCXQR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |