C22H27NO5 — CID 89313647
[2-(methylamino)-2-phenylpent-4-enyl] 3,4,5-trimethoxybenzoate (PubChem CID 89313647) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [2-(methylamino)-2-phenylpent-4-enyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(methylamino)-2-phenylpent-4-enyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 89313647 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [2-(methylamino)-2-phenylpent-4-enyl] 3,4,5-trimethoxybenzoate |
| SMILES | C=CCC(COC(=O)c1cc(OC)c(OC)c(OC)c1)(NC)c1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-6-12-22(23-2,17-10-8-7-9-11-17)15-28-21(24)16-13-18(25-3)20(27-5)19(14-16)26-4/h6-11,13-14,23H,1,12,15H2,2-5H3 |
| InChIKey | OEUPXEICUCAQHH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|