C23H28ClNO7 — CID 76619034
[2-[chloromethoxycarbonyl(methyl)amino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate (PubChem CID 76619034) has the molecular formula C23H28ClNO7 and a molecular weight of 465.93 g/mol. Its IUPAC name is [2-[chloromethoxycarbonyl(methyl)amino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[chloromethoxycarbonyl(methyl)amino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 76619034 |
| Molecular Formula | C23H28ClNO7 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [2-[chloromethoxycarbonyl(methyl)amino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCC(COC(=O)c1cc(OC)c(OC)c(OC)c1)(c1ccccc1)N(C)C(=O)OCCl |
| InChI | InChI=1S/C23H28ClNO7/c1-6-23(17-10-8-7-9-11-17,25(2)22(27)32-15-24)14-31-21(26)16-12-18(28-3)20(30-5)19(13-16)29-4/h7-13H,6,14-15H2,1-5H3 |
| InChIKey | VJMMMBPBGZMVGZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|