C30H36N2O7S — CID 87318746
carbamothioyl benzoate;[2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate (PubChem CID 87318746) has the molecular formula C30H36N2O7S and a molecular weight of 568.69 g/mol. Its IUPAC name is carbamothioyl benzoate;[2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate.
| Compound Name | carbamothioyl benzoate;[2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 87318746 |
| Molecular Formula | C30H36N2O7S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | carbamothioyl benzoate;[2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCC(COC(=O)c1cc(OC)c(OC)c(OC)c1)(c1ccccc1)N(C)C.NC(=S)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H29NO5.C8H7NO2S/c1-7-22(23(2)3,17-11-9-8-10-12-17)15-28-21(24)16-13-18(25-4)20(27-6)19(14-16)26-5;9-8(12)11-7(10)6-4-2-1-3-5-6/h8-14H,7,15H2,1-6H3;1-5H,(H2,9,12) |
| InChIKey | YLGJNSQAQWSLBT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|