C27H36N2O8S2 — CID 71737191
[2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;2,5-dimethyl-1,3-thiazole-4-sulfonic acid (PubChem CID 71737191) has the molecular formula C27H36N2O8S2 and a molecular weight of 580.73 g/mol. Its IUPAC name is [2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;2,5-dimethyl-1,3-thiazole-4-sulfonic acid.
| Compound Name | [2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;2,5-dimethyl-1,3-thiazole-4-sulfonic acid |
|---|---|
| PubChem CID | 71737191 |
| Molecular Formula | C27H36N2O8S2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | [2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;2,5-dimethyl-1,3-thiazole-4-sulfonic acid |
| SMILES | CCC(COC(=O)c1cc(OC)c(OC)c(OC)c1)(c1ccccc1)N(C)C.Cc1nc(S(=O)(=O)O)c(C)s1 |
| InChI | InChI=1S/C22H29NO5.C5H7NO3S2/c1-7-22(23(2)3,17-11-9-8-10-12-17)15-28-21(24)16-13-18(25-4)20(27-6)19(14-16)26-5;1-3-5(11(7,8)9)6-4(2)10-3/h8-14H,7,15H2,1-6H3;1-2H3,(H,7,8,9) |
| InChIKey | SABMNVRZYKOWGF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|