C21H28ClNO5 — CID 175674676
[(2R)-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride (PubChem CID 175674676) has the molecular formula C21H28ClNO5 and a molecular weight of 409.91 g/mol. Its IUPAC name is [(2R)-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride.
| Compound Name | [(2R)-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 175674676 |
| Molecular Formula | C21H28ClNO5 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [(2R)-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride |
| SMILES | CC[C@@](COC(=O)c1cc(OC)c(OC)c(OC)c1)(NC)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO5.ClH/c1-6-21(22-2,16-10-8-7-9-11-16)14-27-20(23)15-12-17(24-3)19(26-5)18(13-15)25-4;/h7-13,22H,6,14H2,1-5H3;1H/t21-;/m0./s1 |
| InChIKey | CTXAQAVYYROYHX-BOXHHOBZSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |