C27H33NO7 — CID 177437376
[2-[(4-ethoxy-4-oxobut-2-ynyl)-methylamino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate (PubChem CID 177437376) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobut-2-ynyl)-methylamino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(4-ethoxy-4-oxobut-2-ynyl)-methylamino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 177437376 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobut-2-ynyl)-methylamino]-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOC(=O)C#CCN(C)C(CC)(COC(=O)c1cc(OC)c(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO7/c1-7-27(21-13-10-9-11-14-21,28(3)16-12-15-24(29)34-8-2)19-35-26(30)20-17-22(31-4)25(33-6)23(18-20)32-5/h9-11,13-14,17-18H,7-8,16,19H2,1-6H3 |
| InChIKey | JXYBLCPHOPJKEB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|