C15H18O5 — CID 53231025
prop-2-enyl 3,5-dimethoxy-4-prop-2-enoxybenzoate (PubChem CID 53231025) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is prop-2-enyl 3,5-dimethoxy-4-prop-2-enoxybenzoate.
| Compound Name | prop-2-enyl 3,5-dimethoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 53231025 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | prop-2-enyl 3,5-dimethoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOC(=O)c1cc(OC)c(OCC=C)c(OC)c1 |
| InChI | InChI=1S/C15H18O5/c1-5-7-19-14-12(17-3)9-11(10-13(14)18-4)15(16)20-8-6-2/h5-6,9-10H,1-2,7-8H2,3-4H3 |
| InChIKey | TVEZCTRFKWYOPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|