C20H19ClO6 — CID 91680031
prop-2-enyl 3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxybenzoate (PubChem CID 91680031) has the molecular formula C20H19ClO6 and a molecular weight of 390.82 g/mol. Its IUPAC name is prop-2-enyl 3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxybenzoate.
| Compound Name | prop-2-enyl 3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 91680031 |
| Molecular Formula | C20H19ClO6 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | prop-2-enyl 3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxybenzoate |
| SMILES | C=CCOC(=O)c1cc(Cl)c(OC(=O)c2ccc(OC)cc2)c(OCC)c1 |
| InChI | InChI=1S/C20H19ClO6/c1-4-10-26-19(22)14-11-16(21)18(17(12-14)25-5-2)27-20(23)13-6-8-15(24-3)9-7-13/h4,6-9,11-12H,1,5,10H2,2-3H3 |
| InChIKey | WPLZZLGDOKHLEN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|