C23H20ClNO5S2 — CID 2277140
[2-chloro-6-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate (PubChem CID 2277140) has the molecular formula C23H20ClNO5S2 and a molecular weight of 490.00 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-chloro-6-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2277140 |
| Molecular Formula | C23H20ClNO5S2 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
| SMILES | C=CCN1C(=O)/C(=C\c2cc(Cl)c(OC(=O)c3ccc(OC)cc3)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C23H20ClNO5S2/c1-4-10-25-21(26)19(32-23(25)31)13-14-11-17(24)20(18(12-14)29-5-2)30-22(27)15-6-8-16(28-3)9-7-15/h4,6-9,11-13H,1,5,10H2,2-3H3/b19-13+ |
| InChIKey | QMNIDYLTZVZBND-CPNJWEJPSA-N |
| XLogP | 5.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|