C20H16ClNO5S2 — CID 19575019
[2-chloro-6-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate (PubChem CID 19575019) has the molecular formula C20H16ClNO5S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-chloro-6-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 19575019 |
| Molecular Formula | C20H16ClNO5S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(/C=C2\SC(=S)NC2=O)cc(Cl)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H16ClNO5S2/c1-3-26-15-9-11(10-16-18(23)22-20(28)29-16)8-14(21)17(15)27-19(24)12-4-6-13(25-2)7-5-12/h4-10H,3H2,1-2H3,(H,22,23,28)/b16-10- |
| InChIKey | HMQFUOHQHCPPGN-YBEGLDIGSA-N |
| XLogP | 4.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|