C21H17ClN2O6S — CID 19574996
[2-chloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenyl] 4-methoxybenzoate (PubChem CID 19574996) has the molecular formula C21H17ClN2O6S and a molecular weight of 460.90 g/mol. Its IUPAC name is [2-chloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenyl] 4-methoxybenzoate.
| Compound Name | [2-chloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 19574996 |
| Molecular Formula | C21H17ClN2O6S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | [2-chloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)NC2=O)cc(Cl)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H17ClN2O6S/c1-3-29-16-10-11(8-14-18(25)23-21(31)24-19(14)26)9-15(22)17(16)30-20(27)12-4-6-13(28-2)7-5-12/h4-10H,3H2,1-2H3,(H2,23,24,25,26,31) |
| InChIKey | UVUBNAIVKXNLAW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|