C22H20ClN3O7S — CID 135548141
2-[2-[[3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135548141) has the molecular formula C22H20ClN3O7S and a molecular weight of 505.94 g/mol. Its IUPAC name is 2-[2-[[3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135548141 |
| Molecular Formula | C22H20ClN3O7S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-[2-[[3-chloro-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)cc(Cl)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20ClN3O7S/c1-3-32-16-9-12(11-24-26-22-25-20(29)17(34-22)10-18(27)28)8-15(23)19(16)33-21(30)13-4-6-14(31-2)7-5-13/h4-9,11,17H,3,10H2,1-2H3,(H,27,28)(H,25,26,29) |
| InChIKey | BZFPBORMLJPUFE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|