C21H19BrClN3O5S — CID 136829488
2-[(2Z,5S)-2-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 136829488) has the molecular formula C21H19BrClN3O5S and a molecular weight of 540.82 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5S)-2-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136829488 |
| Molecular Formula | C21H19BrClN3O5S |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | 2-[(2Z,5S)-2-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1cc(/C=N\N=C2\NC(=O)[C@H](CC(=O)O)S2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19BrClN3O5S/c1-2-30-16-8-13(10-24-26-21-25-20(29)17(32-21)9-18(27)28)7-15(22)19(16)31-11-12-3-5-14(23)6-4-12/h3-8,10,17H,2,9,11H2,1H3,(H,27,28)(H,25,26,29)/b24-10-/t17-/m0/s1 |
| InChIKey | IKBGYZKBURKAPP-FRRODPEASA-N |
| XLogP | 4.48 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|