C28H27BrN4O4S — CID 135532629
2-[2-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135532629) has the molecular formula C28H27BrN4O4S and a molecular weight of 595.52 g/mol. Its IUPAC name is 2-[2-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135532629 |
| Molecular Formula | C28H27BrN4O4S |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | 2-[2-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | CCOc1cc(C=NN=C2NC(=O)C(CC(=O)Nc3ccccc3)S2)cc(Br)c1OCc1ccccc1C |
| InChI | InChI=1S/C28H27BrN4O4S/c1-3-36-23-14-19(13-22(29)26(23)37-17-20-10-8-7-9-18(20)2)16-30-33-28-32-27(35)24(38-28)15-25(34)31-21-11-5-4-6-12-21/h4-14,16,24H,3,15,17H2,1-2H3,(H,31,34)(H,32,33,35) |
| InChIKey | RMWPDVSALVNJFX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|