C27H26N4O4S — CID 136859962
2-[(2Z,5R)-2-[(Z)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 136859962) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 136859962 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | COc1cc(/C=N\N=C2\NC(=O)[C@@H](CC(=O)Nc3ccccc3)S2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H26N4O4S/c1-18-8-10-19(11-9-18)17-35-22-13-12-20(14-23(22)34-2)16-28-31-27-30-26(33)24(36-27)15-25(32)29-21-6-4-3-5-7-21/h3-14,16,24H,15,17H2,1-2H3,(H,29,32)(H,30,31,33)/b28-16-/t24-/m1/s1 |
| InChIKey | JMHMWHSTUBEWQF-OPJDEBTLSA-N |
| XLogP | 4.53 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|