C26H23IN4O6S2 — CID 136829460
[4-[(Z)-[(Z)-[(5R)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-iodo-6-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 136829460) has the molecular formula C26H23IN4O6S2 and a molecular weight of 678.53 g/mol. Its IUPAC name is [4-[(Z)-[(Z)-[(5R)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-iodo-6-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[(Z)-[(5R)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-iodo-6-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 136829460 |
| Molecular Formula | C26H23IN4O6S2 |
| Molecular Weight | 678.53 g/mol |
| Exact Mass | 678.01 |
| IUPAC Name | [4-[(Z)-[(Z)-[(5R)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-iodo-6-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=N\N=C2\NC(=O)[C@@H](CC(=O)Nc3ccccc3)S2)cc(I)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H23IN4O6S2/c1-16-8-10-19(11-9-16)39(34,35)37-24-20(27)12-17(13-21(24)36-2)15-28-31-26-30-25(33)22(38-26)14-23(32)29-18-6-4-3-5-7-18/h3-13,15,22H,14H2,1-2H3,(H,29,32)(H,30,31,33)/b28-15-/t22-/m1/s1 |
| InChIKey | SLTDHJRRYQHODF-HSMHNTNPSA-N |
| XLogP | 4.33 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|