C21H20IN3O7S2 — CID 136829451
2-[(2Z,5S)-2-[(Z)-[3-ethoxy-5-iodo-4-(4-methylphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 136829451) has the molecular formula C21H20IN3O7S2 and a molecular weight of 617.44 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(Z)-[3-ethoxy-5-iodo-4-(4-methylphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5S)-2-[(Z)-[3-ethoxy-5-iodo-4-(4-methylphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136829451 |
| Molecular Formula | C21H20IN3O7S2 |
| Molecular Weight | 617.44 g/mol |
| Exact Mass | 616.98 |
| IUPAC Name | 2-[(2Z,5S)-2-[(Z)-[3-ethoxy-5-iodo-4-(4-methylphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1cc(/C=N\N=C2\NC(=O)[C@H](CC(=O)O)S2)cc(I)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20IN3O7S2/c1-3-31-16-9-13(11-23-25-21-24-20(28)17(33-21)10-18(26)27)8-15(22)19(16)32-34(29,30)14-6-4-12(2)5-7-14/h4-9,11,17H,3,10H2,1-2H3,(H,26,27)(H,24,25,28)/b23-11-/t17-/m0/s1 |
| InChIKey | MFAQBEXUTPKDNI-CMBCABCVSA-N |
| XLogP | 3.16 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|