C23H19N3O6S2 — CID 136845386
2-[(2Z,5R)-2-[(Z)-[2-(4-methylphenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 136845386) has the molecular formula C23H19N3O6S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-[2-(4-methylphenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-[2-(4-methylphenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136845386 |
| Molecular Formula | C23H19N3O6S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-[2-(4-methylphenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2/C=N\N=C2\NC(=O)[C@@H](CC(=O)O)S2)cc1 |
| InChI | InChI=1S/C23H19N3O6S2/c1-14-6-9-16(10-7-14)34(30,31)32-19-11-8-15-4-2-3-5-17(15)18(19)13-24-26-23-25-22(29)20(33-23)12-21(27)28/h2-11,13,20H,12H2,1H3,(H,27,28)(H,25,26,29)/b24-13-/t20-/m1/s1 |
| InChIKey | KFDCSYCGNVKFRZ-GEUHTFEZSA-N |
| XLogP | 3.31 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|