C21H21N3O8S2 — CID 135494903
2-[2-[[3-ethoxy-4-(4-methoxyphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135494903) has the molecular formula C21H21N3O8S2 and a molecular weight of 507.55 g/mol. Its IUPAC name is 2-[2-[[3-ethoxy-4-(4-methoxyphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-ethoxy-4-(4-methoxyphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135494903 |
| Molecular Formula | C21H21N3O8S2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-[2-[[3-ethoxy-4-(4-methoxyphenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1OS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21N3O8S2/c1-3-31-17-10-13(12-22-24-21-23-20(27)18(33-21)11-19(25)26)4-9-16(17)32-34(28,29)15-7-5-14(30-2)6-8-15/h4-10,12,18H,3,11H2,1-2H3,(H,25,26)(H,23,24,27) |
| InChIKey | POFCRJXIWCCDIW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|