C24H20ClN3O5S — CID 135895463
2-[(2Z,5R)-2-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135895463) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135895463 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(/C=N\N=C2\NC(=O)[C@@H](CC(=O)O)S2)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H20ClN3O5S/c1-32-19-10-14(12-26-28-24-27-23(31)20(34-24)11-21(29)30)9-18(25)22(19)33-13-16-7-4-6-15-5-2-3-8-17(15)16/h2-10,12,20H,11,13H2,1H3,(H,29,30)(H,27,28,31)/b26-12-/t20-/m1/s1 |
| InChIKey | FTEGMHPVWGZHRD-ZDPZLCMCSA-N |
| XLogP | 4.48 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|