C20H20ClN3O4S — CID 135753902
(2E)-5-[(2-chlorophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135753902) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is (2E)-5-[(2-chlorophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(2-chlorophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135753902 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (2E)-5-[(2-chlorophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=N/N=C2\NC(=O)C(Cc3ccccc3Cl)S2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20ClN3O4S/c1-26-15-8-12(9-16(27-2)18(15)28-3)11-22-24-20-23-19(25)17(29-20)10-13-6-4-5-7-14(13)21/h4-9,11,17H,10H2,1-3H3,(H,23,24,25) |
| InChIKey | GYKLUOZHUBBBAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|