C20H17ClF3N3O3S — CID 135447413
(2E)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[(E)-(3,4-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135447413) has the molecular formula C20H17ClF3N3O3S and a molecular weight of 471.89 g/mol. Its IUPAC name is (2E)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[(E)-(3,4-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[(E)-(3,4-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135447413 |
| Molecular Formula | C20H17ClF3N3O3S |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (2E)-5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-2-[(E)-(3,4-dimethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=N/N=C2\NC(=O)C(Cc3cc(C(F)(F)F)ccc3Cl)S2)cc1OC |
| InChI | InChI=1S/C20H17ClF3N3O3S/c1-29-15-6-3-11(7-16(15)30-2)10-25-27-19-26-18(28)17(31-19)9-12-8-13(20(22,23)24)4-5-14(12)21/h3-8,10,17H,9H2,1-2H3,(H,26,27,28)/b25-10+ |
| InChIKey | RJTRDYPIJUYMHG-KIBLKLHPSA-N |
| XLogP | 4.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|