C24H19N3O6S — CID 135500909
2-[(2E)-2-[(E)-[3-methoxy-4-(naphthalene-1-carbonyloxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135500909) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-[3-methoxy-4-(naphthalene-1-carbonyloxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-[3-methoxy-4-(naphthalene-1-carbonyloxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135500909 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-[(2E)-2-[(E)-[3-methoxy-4-(naphthalene-1-carbonyloxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(/C=N/N=C2\NC(=O)C(CC(=O)O)S2)ccc1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H19N3O6S/c1-32-19-11-14(13-25-27-24-26-22(30)20(34-24)12-21(28)29)9-10-18(19)33-23(31)17-8-4-6-15-5-2-3-7-16(15)17/h2-11,13,20H,12H2,1H3,(H,28,29)(H,26,27,30)/b25-13+ |
| InChIKey | XLJCOYLNKDONDE-DHRITJCHSA-N |
| XLogP | 3.46 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|