C31H26N4O6S — CID 135689258
[2-methoxy-5-[[(Z)-[5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 135689258) has the molecular formula C31H26N4O6S and a molecular weight of 582.64 g/mol. Its IUPAC name is [2-methoxy-5-[[(Z)-[5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [2-methoxy-5-[[(Z)-[5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135689258 |
| Molecular Formula | C31H26N4O6S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [2-methoxy-5-[[(Z)-[5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N\N=Cc3ccc(OC)c(OC(=O)c4cccc5ccccc45)c3)NC2=O)cc1 |
| InChI | InChI=1S/C31H26N4O6S/c1-39-22-13-11-21(12-14-22)33-28(36)17-27-29(37)34-31(42-27)35-32-18-19-10-15-25(40-2)26(16-19)41-30(38)24-9-5-7-20-6-3-4-8-23(20)24/h3-16,18,27H,17H2,1-2H3,(H,33,36)(H,34,35,37) |
| InChIKey | BFIUJYRRFJETMB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|