C23H21ClN4O5S — CID 135736645
2-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 135736645) has the molecular formula C23H21ClN4O5S and a molecular weight of 500.96 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135736645 |
| Molecular Formula | C23H21ClN4O5S |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2-[(2Z)-2-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C#CCOc1c(Cl)cc(C=N/N=C2/NC(=O)C(CC(=O)Nc3ccc(OC)cc3)S2)cc1OC |
| InChI | InChI=1S/C23H21ClN4O5S/c1-4-9-33-21-17(24)10-14(11-18(21)32-3)13-25-28-23-27-22(30)19(34-23)12-20(29)26-15-5-7-16(31-2)8-6-15/h1,5-8,10-11,13,19H,9,12H2,2-3H3,(H,26,29)(H,27,28,30) |
| InChIKey | JPQVZQRSTKCGML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|