C21H15ClFNO4S2 — CID 3948746
[2-chloro-6-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-fluorobenzoate (PubChem CID 3948746) has the molecular formula C21H15ClFNO4S2 and a molecular weight of 463.94 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [2-chloro-6-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 3948746 |
| Molecular Formula | C21H15ClFNO4S2 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | [2-chloro-6-methoxy-4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-fluorobenzoate |
| SMILES | C=CCN1C(=O)C(=Cc2cc(Cl)c(OC(=O)c3ccccc3F)c(OC)c2)SC1=S |
| InChI | InChI=1S/C21H15ClFNO4S2/c1-3-8-24-19(25)17(30-21(24)29)11-12-9-14(22)18(16(10-12)27-2)28-20(26)13-6-4-5-7-15(13)23/h3-7,9-11H,1,8H2,2H3 |
| InChIKey | ALSYRQRMSZEKOJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|