C16H15NO4S2 — CID 2940781
[2-methoxy-5-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate (PubChem CID 2940781) has the molecular formula C16H15NO4S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-methoxy-5-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 2940781 |
| Molecular Formula | C16H15NO4S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | [2-methoxy-5-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OC)c(OC(C)=O)c2)SC1=S |
| InChI | InChI=1S/C16H15NO4S2/c1-4-7-17-15(19)14(23-16(17)22)9-11-5-6-12(20-3)13(8-11)21-10(2)18/h4-6,8-9H,1,7H2,2-3H3 |
| InChIKey | BVLXSOPCIIIKQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|