C19H17Cl2FO4 — CID 91682255
prop-2-enyl 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoate (PubChem CID 91682255) has the molecular formula C19H17Cl2FO4 and a molecular weight of 399.25 g/mol. Its IUPAC name is prop-2-enyl 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoate.
| Compound Name | prop-2-enyl 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoate |
|---|---|
| PubChem CID | 91682255 |
| Molecular Formula | C19H17Cl2FO4 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | prop-2-enyl 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoate |
| SMILES | C=CCOC(=O)c1cc(Cl)c(OCc2ccc(F)cc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C19H17Cl2FO4/c1-3-7-25-19(23)13-8-16(21)18(17(9-13)24-4-2)26-11-12-5-6-14(22)10-15(12)20/h3,5-6,8-10H,1,4,7,11H2,2H3 |
| InChIKey | WWQXJQHSWSSOIB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|