C16H13Cl2FN2O3S — CID 132591240
N-carbamothioyl-3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxybenzamide (PubChem CID 132591240) has the molecular formula C16H13Cl2FN2O3S and a molecular weight of 403.26 g/mol. Its IUPAC name is N-carbamothioyl-3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxybenzamide.
| Compound Name | N-carbamothioyl-3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxybenzamide |
|---|---|
| PubChem CID | 132591240 |
| Molecular Formula | C16H13Cl2FN2O3S |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | N-carbamothioyl-3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC(N)=S)cc(Cl)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O3S/c1-23-13-5-9(15(22)21-16(20)25)4-12(18)14(13)24-7-8-2-3-10(19)6-11(8)17/h2-6H,7H2,1H3,(H3,20,21,22,25) |
| InChIKey | IAUNXBULHKOTQE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|