C16H13Cl2FO4 — CID 91682258
3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoic acid (PubChem CID 91682258) has the molecular formula C16H13Cl2FO4 and a molecular weight of 359.18 g/mol. Its IUPAC name is 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoic acid.
| Compound Name | 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoic acid |
|---|---|
| PubChem CID | 91682258 |
| Molecular Formula | C16H13Cl2FO4 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)cc(Cl)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FO4/c1-2-22-14-6-10(16(20)21)5-13(18)15(14)23-8-9-3-4-11(19)7-12(9)17/h3-7H,2,8H2,1H3,(H,20,21) |
| InChIKey | WPAZSUOXQYKANV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |