C19H18ClFO4 — CID 91682236
prop-2-enyl 3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]benzoate (PubChem CID 91682236) has the molecular formula C19H18ClFO4 and a molecular weight of 364.80 g/mol. Its IUPAC name is prop-2-enyl 3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]benzoate.
| Compound Name | prop-2-enyl 3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 91682236 |
| Molecular Formula | C19H18ClFO4 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | prop-2-enyl 3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]benzoate |
| SMILES | C=CCOC(=O)c1cc(Cl)c(OCc2cccc(F)c2)c(OCC)c1 |
| InChI | InChI=1S/C19H18ClFO4/c1-3-8-24-19(22)14-10-16(20)18(17(11-14)23-4-2)25-12-13-6-5-7-15(21)9-13/h3,5-7,9-11H,1,4,8,12H2,2H3 |
| InChIKey | KMKSRLJKSCIMKX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|