C15H11Cl2FO3 — CID 91682725
methyl 3,5-dichloro-4-[(3-fluorophenyl)methoxy]benzoate (PubChem CID 91682725) has the molecular formula C15H11Cl2FO3 and a molecular weight of 329.15 g/mol. Its IUPAC name is methyl 3,5-dichloro-4-[(3-fluorophenyl)methoxy]benzoate.
| Compound Name | methyl 3,5-dichloro-4-[(3-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 91682725 |
| Molecular Formula | C15H11Cl2FO3 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | methyl 3,5-dichloro-4-[(3-fluorophenyl)methoxy]benzoate |
| SMILES | COC(=O)c1cc(Cl)c(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2FO3/c1-20-15(19)10-6-12(16)14(13(17)7-10)21-8-9-3-2-4-11(18)5-9/h2-7H,8H2,1H3 |
| InChIKey | WGKFMTHYWHAEQG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |