C48H56O12 — CID 71734980
4,6,11,13,18,20,25,27-octamethoxy-5,12,19,26-tetrakis(prop-2-enoxy)pentacyclo[22.4.0.03,8.010,15.017,22]octacosa-1(28),3,5,7,10,12,14,17,19,21,24,26-dodecaene (PubChem CID 71734980) has the molecular formula C48H56O12 and a molecular weight of 824.96 g/mol. Its IUPAC name is 4,6,11,13,18,20,25,27-octamethoxy-5,12,19,26-tetrakis(prop-2-enoxy)pentacyclo[22.4.0.03,8.010,15.017,22]octacosa-1(28),3,5,7,10,12,14,17,19,21,24,26-dodecaene.
| Compound Name | 4,6,11,13,18,20,25,27-octamethoxy-5,12,19,26-tetrakis(prop-2-enoxy)pentacyclo[22.4.0.03,8.010,15.017,22]octacosa-1(28),3,5,7,10,12,14,17,19,21,24,26-dodecaene |
|---|---|
| PubChem CID | 71734980 |
| Molecular Formula | C48H56O12 |
| Molecular Weight | 824.96 g/mol |
| Exact Mass | 824.38 |
| IUPAC Name | 4,6,11,13,18,20,25,27-octamethoxy-5,12,19,26-tetrakis(prop-2-enoxy)pentacyclo[22.4.0.03,8.010,15.017,22]octacosa-1(28),3,5,7,10,12,14,17,19,21,24,26-dodecaene |
| SMILES | C=CCOc1c(OC)cc2c(c1OC)Cc1cc(OC)c(OCC=C)c(OC)c1Cc1cc(OC)c(OCC=C)c(OC)c1Cc1cc(OC)c(OCC=C)c(OC)c1C2 |
| InChI | InChI=1S/C48H56O12/c1-13-17-57-45-37(49-5)25-29-22-34-31(27-39(51-7)47(42(34)54-10)59-19-15-3)24-36-32(28-40(52-8)48(44(36)56-12)60-20-16-4)23-35-30(21-33(29)41(45)53-9)26-38(50-6)46(43(35)55-11)58-18-14-2/h13-16,25-28H,1-4,17-24H2,5-12H3 |
| InChIKey | LBAGKZRLNUMUEZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.96 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|