C27H30O6 — CID 4140999
4,5,12,13,19,20-hexamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene (PubChem CID 4140999) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is 4,5,12,13,19,20-hexamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene.
| Compound Name | 4,5,12,13,19,20-hexamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 4140999 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4,5,12,13,19,20-hexamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3(8),4,6,10,12,14,17,19-nonaene |
| SMILES | COc1cc2c(cc1OC)Cc1ccc(OC)c(OC)c1Cc1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C27H30O6/c1-28-22-8-7-16-9-17-12-23(29-2)24(30-3)13-18(17)10-19-14-25(31-4)26(32-5)15-20(19)11-21(16)27(22)33-6/h7-8,12-15H,9-11H2,1-6H3 |
| InChIKey | SDWFZMQBLJZRFQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |