C14H12O4 — CID 10752785
5,6-dimethoxy-3,8-dihydrocyclobuta[b]naphthalene-1,2-dione (PubChem CID 10752785) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5,6-dimethoxy-3,8-dihydrocyclobuta[b]naphthalene-1,2-dione.
| Compound Name | 5,6-dimethoxy-3,8-dihydrocyclobuta[b]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 10752785 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5,6-dimethoxy-3,8-dihydrocyclobuta[b]naphthalene-1,2-dione |
| SMILES | COc1cc2c(cc1OC)Cc1c(c(=O)c1=O)C2 |
| InChI | InChI=1S/C14H12O4/c1-17-11-5-7-3-9-10(14(16)13(9)15)4-8(7)6-12(11)18-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | JLXNMQSCQBNSOQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|