C12H15NO3 — CID 11401769
7,8-dimethoxy-1,2,3,5-tetrahydro-3-benzazepin-4-one (PubChem CID 11401769) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 7,8-dimethoxy-1,2,3,5-tetrahydro-3-benzazepin-4-one.
| Compound Name | 7,8-dimethoxy-1,2,3,5-tetrahydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 11401769 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 7,8-dimethoxy-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| SMILES | COc1cc2c(cc1OC)CC(=O)NCC2 |
| InChI | InChI=1S/C12H15NO3/c1-15-10-5-8-3-4-13-12(14)7-9(8)6-11(10)16-2/h5-6H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | RXKTVGMZJMDNLF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |