C23H29NO3Si — CID 10692103
(2E)-17,18-dimethoxy-2-trimethylsilyl-12-azatricyclo[13.4.0.04,9]nonadeca-1(19),2,4,6,8,15,17-heptaen-11-one (PubChem CID 10692103) has the molecular formula C23H29NO3Si and a molecular weight of 395.58 g/mol. Its IUPAC name is (2E)-17,18-dimethoxy-2-trimethylsilyl-12-azatricyclo[13.4.0.04,9]nonadeca-1(19),2,4,6,8,15,17-heptaen-11-one.
| Compound Name | (2E)-17,18-dimethoxy-2-trimethylsilyl-12-azatricyclo[13.4.0.04,9]nonadeca-1(19),2,4,6,8,15,17-heptaen-11-one |
|---|---|
| PubChem CID | 10692103 |
| Molecular Formula | C23H29NO3Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2E)-17,18-dimethoxy-2-trimethylsilyl-12-azatricyclo[13.4.0.04,9]nonadeca-1(19),2,4,6,8,15,17-heptaen-11-one |
| SMILES | COc1cc2c(cc1OC)/C([Si](C)(C)C)=C\c1ccccc1CC(=O)NCC2 |
| InChI | InChI=1S/C23H29NO3Si/c1-26-20-12-18-10-11-24-23(25)14-17-9-7-6-8-16(17)13-22(28(3,4)5)19(18)15-21(20)27-2/h6-9,12-13,15H,10-11,14H2,1-5H3,(H,24,25)/b22-13+ |
| InChIKey | CRDJAAQGWXUYKM-LPYMAVHISA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|