C22H27NO3Si — CID 10948938
(13E)-10,11-dimethoxy-13-trimethylsilyl-7,8-dihydro-6H-benzo[e][2]benzazecin-5-one (PubChem CID 10948938) has the molecular formula C22H27NO3Si and a molecular weight of 381.55 g/mol. Its IUPAC name is (13E)-10,11-dimethoxy-13-trimethylsilyl-7,8-dihydro-6H-benzo[e][2]benzazecin-5-one.
| Compound Name | (13E)-10,11-dimethoxy-13-trimethylsilyl-7,8-dihydro-6H-benzo[e][2]benzazecin-5-one |
|---|---|
| PubChem CID | 10948938 |
| Molecular Formula | C22H27NO3Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (13E)-10,11-dimethoxy-13-trimethylsilyl-7,8-dihydro-6H-benzo[e][2]benzazecin-5-one |
| SMILES | COc1cc2c(cc1OC)/C([Si](C)(C)C)=C\c1ccccc1C(=O)NCC2 |
| InChI | InChI=1S/C22H27NO3Si/c1-25-19-12-16-10-11-23-22(24)17-9-7-6-8-15(17)13-21(27(3,4)5)18(16)14-20(19)26-2/h6-9,12-14H,10-11H2,1-5H3,(H,23,24)/b21-13+ |
| InChIKey | ZWLOOIUQOSROKM-FYJGNVAPSA-N |
| XLogP | 4.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|