C23H27NO5Si — CID 10812316
(2E)-7,8-dimethoxy-2-trimethylsilyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),2,4(9),5,7,14,16(20)-heptaen-10-one (PubChem CID 10812316) has the molecular formula C23H27NO5Si and a molecular weight of 425.56 g/mol. Its IUPAC name is (2E)-7,8-dimethoxy-2-trimethylsilyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),2,4(9),5,7,14,16(20)-heptaen-10-one.
| Compound Name | (2E)-7,8-dimethoxy-2-trimethylsilyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),2,4(9),5,7,14,16(20)-heptaen-10-one |
|---|---|
| PubChem CID | 10812316 |
| Molecular Formula | C23H27NO5Si |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2E)-7,8-dimethoxy-2-trimethylsilyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),2,4(9),5,7,14,16(20)-heptaen-10-one |
| SMILES | COc1ccc2c(c1OC)C(=O)NCCc1cc3c(cc1/C([Si](C)(C)C)=C\2)OCO3 |
| InChI | InChI=1S/C23H27NO5Si/c1-26-17-7-6-15-11-20(30(3,4)5)16-12-19-18(28-13-29-19)10-14(16)8-9-24-23(25)21(15)22(17)27-2/h6-7,10-12H,8-9,13H2,1-5H3,(H,24,25)/b20-11+ |
| InChIKey | RCPSMDQSHSZBPL-RGVLZGJSSA-N |
| XLogP | 4.14 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|