C19H21N3O4 — CID 5251439
16,18-dimethoxy-4,8,12-triazatricyclo[13.2.2.16,10]icosa-1(17),6(20),7,9,15,18-hexaene-5,11-dione (PubChem CID 5251439) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 16,18-dimethoxy-4,8,12-triazatricyclo[13.2.2.16,10]icosa-1(17),6(20),7,9,15,18-hexaene-5,11-dione.
| Compound Name | 16,18-dimethoxy-4,8,12-triazatricyclo[13.2.2.16,10]icosa-1(17),6(20),7,9,15,18-hexaene-5,11-dione |
|---|---|
| PubChem CID | 5251439 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 16,18-dimethoxy-4,8,12-triazatricyclo[13.2.2.16,10]icosa-1(17),6(20),7,9,15,18-hexaene-5,11-dione |
| SMILES | COc1cc2c(OC)cc1CCNC(=O)c1cncc(c1)C(=O)NCC2 |
| InChI | InChI=1S/C19H21N3O4/c1-25-16-8-13-4-6-22-19(24)15-7-14(10-20-11-15)18(23)21-5-3-12(16)9-17(13)26-2/h7-11H,3-6H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GFQRYURJORTXSZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |