C14H12N2O2 — CID 140925375
5-methoxy-6-pyridin-3-yl-2,3-dihydroisoindol-1-one (PubChem CID 140925375) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-methoxy-6-pyridin-3-yl-2,3-dihydroisoindol-1-one.
| Compound Name | 5-methoxy-6-pyridin-3-yl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 140925375 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-methoxy-6-pyridin-3-yl-2,3-dihydroisoindol-1-one |
| SMILES | COc1cc2c(cc1-c1cccnc1)C(=O)NC2 |
| InChI | InChI=1S/C14H12N2O2/c1-18-13-5-10-8-16-14(17)12(10)6-11(13)9-3-2-4-15-7-9/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | OTUXDCOYFAQJDP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |