C19H18N2O2 — CID 11278183
(2E)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-2-phenylacetonitrile (PubChem CID 11278183) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2E)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-2-phenylacetonitrile.
| Compound Name | (2E)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-2-phenylacetonitrile |
|---|---|
| PubChem CID | 11278183 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2E)-2-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-2-phenylacetonitrile |
| SMILES | COc1cc2c(cc1OC)/C(=C(\C#N)c1ccccc1)NCC2 |
| InChI | InChI=1S/C19H18N2O2/c1-22-17-10-14-8-9-21-19(15(14)11-18(17)23-2)16(12-20)13-6-4-3-5-7-13/h3-7,10-11,21H,8-9H2,1-2H3/b19-16- |
| InChIKey | KFFLNZXBBUYJQL-MNDPQUGUSA-N |
| XLogP | 3.24 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|