C12H17Cl2NO — CID 91339125
dichloromethane;3,4-dihydro-2H-isoquinolin-1-one;ethane (PubChem CID 91339125) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is dichloromethane;3,4-dihydro-2H-isoquinolin-1-one;ethane.
| Compound Name | dichloromethane;3,4-dihydro-2H-isoquinolin-1-one;ethane |
|---|---|
| PubChem CID | 91339125 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | dichloromethane;3,4-dihydro-2H-isoquinolin-1-one;ethane |
| SMILES | CC.ClCCl.O=C1NCCc2ccccc21 |
| InChI | InChI=1S/C9H9NO.C2H6.CH2Cl2/c11-9-8-4-2-1-3-7(8)5-6-10-9;1-2;2-1-3/h1-4H,5-6H2,(H,10,11);1-2H3;1H2 |
| InChIKey | RAVYNCHRJYQBPY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|