C16H18N2O2 — CID 161236583
3,4-dihydro-2H-isoquinolin-1-one;4,6-dimethyl-1H-pyridin-2-one (PubChem CID 161236583) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3,4-dihydro-2H-isoquinolin-1-one;4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3,4-dihydro-2H-isoquinolin-1-one;4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 161236583 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3,4-dihydro-2H-isoquinolin-1-one;4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)[nH]c(=O)c1.O=C1NCCc2ccccc21 |
| InChI | InChI=1S/C9H9NO.C7H9NO/c11-9-8-4-2-1-3-7(8)5-6-10-9;1-5-3-6(2)8-7(9)4-5/h1-4H,5-6H2,(H,10,11);3-4H,1-2H3,(H,8,9) |
| InChIKey | UZLHJDTUJCYFPM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |