C9H15NO — CID 91063629
4,6-dimethyl-1H-pyridin-2-one;ethane (PubChem CID 91063629) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyridin-2-one;ethane.
| Compound Name | 4,6-dimethyl-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 91063629 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4,6-dimethyl-1H-pyridin-2-one;ethane |
| SMILES | CC.Cc1cc(C)[nH]c(=O)c1 |
| InChI | InChI=1S/C7H9NO.C2H6/c1-5-3-6(2)8-7(9)4-5;1-2/h3-4H,1-2H3,(H,8,9);1-2H3 |
| InChIKey | AWVDCKDRODMNTB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |