C7H10ClNO — CID 44887209
2,6-dimethyl-1H-pyridin-4-one;hydrochloride (PubChem CID 44887209) has the molecular formula C7H10ClNO and a molecular weight of 159.62 g/mol. Its IUPAC name is 2,6-dimethyl-1H-pyridin-4-one;hydrochloride.
| Compound Name | 2,6-dimethyl-1H-pyridin-4-one;hydrochloride |
|---|---|
| PubChem CID | 44887209 |
| Molecular Formula | C7H10ClNO |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 2,6-dimethyl-1H-pyridin-4-one;hydrochloride |
| SMILES | Cc1cc(=O)cc(C)[nH]1.Cl |
| InChI | InChI=1S/C7H9NO.ClH/c1-5-3-7(9)4-6(2)8-5;/h3-4H,1-2H3,(H,8,9);1H |
| InChIKey | QVFXKLBWQPIZDJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |