C12H13NO — CID 143874745
2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-1H-pyridin-4-one (PubChem CID 143874745) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-1H-pyridin-4-one.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 143874745 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-1H-pyridin-4-one |
| SMILES | C=C/C=C(\C=C)c1cc(=O)cc(C)[nH]1 |
| InChI | InChI=1S/C12H13NO/c1-4-6-10(5-2)12-8-11(14)7-9(3)13-12/h4-8H,1-2H2,3H3,(H,13,14)/b10-6+ |
| InChIKey | JKEYVRBSXZRSLK-UXBLZVDNSA-N |
| XLogP | 2.44 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|