C20H14FN3O2 — CID 169130487
2-[[8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-4-oxo-1H-quinolin-7-yl]-methoxymethylidene]propanedinitrile (PubChem CID 169130487) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-[[8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-4-oxo-1H-quinolin-7-yl]-methoxymethylidene]propanedinitrile.
| Compound Name | 2-[[8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-4-oxo-1H-quinolin-7-yl]-methoxymethylidene]propanedinitrile |
|---|---|
| PubChem CID | 169130487 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[[8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-4-oxo-1H-quinolin-7-yl]-methoxymethylidene]propanedinitrile |
| SMILES | C=C/C=C(\C=C)c1cc(=O)c2ccc(C(OC)=C(C#N)C#N)c(F)c2[nH]1 |
| InChI | InChI=1S/C20H14FN3O2/c1-4-6-12(5-2)16-9-17(25)14-7-8-15(18(21)19(14)24-16)20(26-3)13(10-22)11-23/h4-9H,1-2H2,3H3,(H,24,25)/b12-6+ |
| InChIKey | WUYLCVWPMULUKG-WUXMJOGZSA-N |
| XLogP | 3.83 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|